608-28-6 2-Iodo-m-xylene
نام محصول |
2-Iodo-m-xylene |
نام انگلیسی |
2-Iodo-m-xylene; 2-Iodo-1,3-Dimethylbenzene |
میدان مغناطیسی |
C8H9I |
وزن مولکولی |
232.0615 |
InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
شماره سیایاس |
608-28-6 |
تعداد کمیسیون اروپایی |
210-158-4 |
ساختار مولکولی |
|
تراکم |
1.61g/cm3 |
نقطه غلیان |
227.5°C at 760 mmHg |
ضریب شکست |
1.592 |
نقطه اشتعال |
98.1°C |
حلالیت آب |
insoluble |
فشار بخار |
0.116mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|