613-13-8 2-Aminoanthracene
نام محصول |
2-Aminoanthracene |
نام انگلیسی |
2-Aminoanthracene; 2-anthramine practical grade*crystalline; 2-anthrylamine; 2-Anthramine; 2-Anthranamine; anthracen-2-amine; 2-Anthracenamide;
|
میدان مغناطیسی |
C14H11N |
وزن مولکولی |
193.2438 |
InChI |
InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
شماره سیایاس |
613-13-8 |
تعداد کمیسیون اروپایی |
210-330-9 |
ساختار مولکولی |
|
تراکم |
1.208g/cm3 |
نقطه ذوب |
238-241℃ |
نقطه غلیان |
414.2°C at 760 mmHg |
ضریب شکست |
1.765 |
نقطه اشتعال |
229°C |
فشار بخار |
4.52E-07mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R33:Danger of cummulative effects.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|