613-21-8 2-methylquinolin-6-ol
نام محصول |
2-methylquinolin-6-ol |
نام انگلیسی |
2-methylquinolin-6-ol; 6-Hydroxy-2-methylquinoline; 2-Methyl-6-hydroxyquinoline; 2-Methyl-6-hydroxyquinoine |
میدان مغناطیسی |
C10H9NO |
وزن مولکولی |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
شماره سیایاس |
613-21-8 |
ساختار مولکولی |
|
تراکم |
1.21g/cm3 |
نقطه ذوب |
198℃ |
نقطه غلیان |
304.5°C at 760 mmHg |
ضریب شکست |
1.666 |
نقطه اشتعال |
142.3°C |
فشار بخار |
0.000483mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|