ChemNet > CAS > 617-05-0 Vanilicacidethylester; 97%
617-05-0 Vanilicacidethylester; 97%
| نام محصول |
Vanilicacidethylester; 97% |
| نام انگلیسی |
Vanilicacidethylester; 97%; Vanilic acid ethyl ester; Ethyl vanillate; Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester; 4-Hydroxy-3-methoxybenzoic acid ethyl ester; ethyl 4-hydroxy-3-methoxybenzoate |
| میدان مغناطیسی |
C10H12O4 |
| وزن مولکولی |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
| شماره سیایاس |
617-05-0 |
| تعداد کمیسیون اروپایی |
210-503-9 |
| ساختار مولکولی |
|
| تراکم |
1.18g/cm3 |
| نقطه ذوب |
39-41℃ |
| نقطه غلیان |
292°C at 760 mmHg |
| ضریب شکست |
1.528 |
| نقطه اشتعال |
122.4°C |
| فشار بخار |
0.00108mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
