ChemNet > CAS > 618-32-6 Benzoyl bromide
618-32-6 Benzoyl bromide
| نام محصول |
Benzoyl bromide |
| نام انگلیسی |
Benzoyl bromide; |
| میدان مغناطیسی |
C7H5BrO |
| وزن مولکولی |
185.018 |
| InChI |
InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| شماره سیایاس |
618-32-6 |
| تعداد کمیسیون اروپایی |
210-544-2 |
| ساختار مولکولی |
|
| تراکم |
1.572g/cm3 |
| نقطه ذوب |
-24℃ |
| نقطه غلیان |
218.5°C at 760 mmHg |
| ضریب شکست |
1.584 |
| نقطه اشتعال |
89.7°C |
| فشار بخار |
0.125mmHg at 25°C |
| خطر نمادها |
 C:Corrosive;
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S25:Avoid contact with eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
