ChemNet > CAS > 618-76-8 4-hydroxy-3,5-diiodobenzoic acid
618-76-8 4-hydroxy-3,5-diiodobenzoic acid
| نام محصول |
4-hydroxy-3,5-diiodobenzoic acid |
| نام انگلیسی |
4-hydroxy-3,5-diiodobenzoic acid; 3,5-Diiodo-4-hydroxybenzoic acid |
| میدان مغناطیسی |
C7H4I2O3 |
| وزن مولکولی |
389.9138 |
| InChI |
InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| شماره سیایاس |
618-76-8 |
| تعداد کمیسیون اروپایی |
210-562-0 |
| ساختار مولکولی |
|
| تراکم |
2.697g/cm3 |
| نقطه غلیان |
346.4°C at 760 mmHg |
| ضریب شکست |
1.784 |
| نقطه اشتعال |
163.3°C |
| فشار بخار |
2.19E-05mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
