ChemNet > CAS > 62348-13-4 Isoxazole-5-carbonyl chloride
62348-13-4 Isoxazole-5-carbonyl chloride
نام محصول |
Isoxazole-5-carbonyl chloride |
نام انگلیسی |
Isoxazole-5-carbonyl chloride; 5-Isoxazolecarboxylic acid chloride; Isoxazole-5-carbonychlordie |
میدان مغناطیسی |
C4H2ClNO2 |
وزن مولکولی |
131.5172 |
InChI |
InChI=1/C4H2ClNO2/c5-4(7)3-1-2-6-8-3/h1-2H |
شماره سیایاس |
62348-13-4 |
ساختار مولکولی |
|
تراکم |
1.432g/cm3 |
نقطه غلیان |
213.213°C at 760 mmHg |
ضریب شکست |
1.497 |
نقطه اشتعال |
82.749°C |
فشار بخار |
0.166mmHg at 25°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|