ChemNet > CAS > 6258-60-2 4-Methoxybenzyl mercaptan
6258-60-2 4-Methoxybenzyl mercaptan
| نام محصول |
4-Methoxybenzyl mercaptan |
| نام انگلیسی |
4-Methoxybenzyl mercaptan; 4-Methoxy-alpha-toluenethiol = 4-Methoxybenzyl Mercaptan; 4-Methoxy-alpha-toluenethiol; (4-methoxyphenyl)methanethiol |
| میدان مغناطیسی |
C8H10OS |
| وزن مولکولی |
154.2294 |
| InChI |
InChI=1/C8H10OS/c1-9-8-4-2-7(6-10)3-5-8/h2-5,10H,6H2,1H3 |
| شماره سیایاس |
6258-60-2 |
| تعداد کمیسیون اروپایی |
228-393-6 |
| ساختار مولکولی |
|
| تراکم |
1.072g/cm3 |
| نقطه غلیان |
294.5°C at 760 mmHg |
| ضریب شکست |
1.549 |
| نقطه اشتعال |
103.4°C |
| فشار بخار |
0.00284mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
