ChemNet > CAS > 626-04-0 benzene-1,3-dithiol
626-04-0 benzene-1,3-dithiol
| نام محصول |
benzene-1,3-dithiol |
| نام انگلیسی |
benzene-1,3-dithiol; 1,3-Benzenedithiol; 1,3-Dimercaptobenzene~Dithioresorcinol |
| میدان مغناطیسی |
C6H6S2 |
| وزن مولکولی |
142.2418 |
| InChI |
InChI=1/C6H6S2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| شماره سیایاس |
626-04-0 |
| تعداد کمیسیون اروپایی |
210-925-3 |
| ساختار مولکولی |
|
| تراکم |
1.24g/cm3 |
| نقطه ذوب |
24-25℃ |
| نقطه غلیان |
244.3°C at 760 mmHg |
| ضریب شکست |
1.665 |
| نقطه اشتعال |
112.7°C |
| فشار بخار |
0.0477mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
