632-22-4 1,1,3,3-Tetramethylurea
نام محصول |
1,1,3,3-Tetramethylurea |
نام انگلیسی |
1,1,3,3-Tetramethylurea; Tetramethylurea |
میدان مغناطیسی |
C5H12N2O |
وزن مولکولی |
116.16 |
InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
شماره سیایاس |
632-22-4 |
تعداد کمیسیون اروپایی |
211-173-9 |
ساختار مولکولی |
|
تراکم |
0.9879 |
نقطه ذوب |
-1℃ |
نقطه غلیان |
174-178℃ |
ضریب شکست |
1.4496-1.4516 |
نقطه اشتعال |
65℃ |
حلالیت آب |
miscible |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:;
|
توضیحات ایمنی |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|