6326-14-3 2,4-Dichlorophenylthiourae

نام محصول	2,4-Dichlorophenylthiourae
نام انگلیسی	2,4-Dichlorophenylthiourae;
میدان مغناطیسی	C₇H₆Cl₂N₂S
وزن مولکولی	221.1069
InChI	InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12)
شماره سیایاس	6326-14-3
ساختار مولکولی
تراکم	1.563g/cm³
نقطه غلیان	321.8°C at 760 mmHg
ضریب شکست	1.73
نقطه اشتعال	148.4°C
فشار بخار	0.000292mmHg at 25°C
خطر نمادها
کدهای خطر	R20/22:Harmful by inhalation and if swallowed.;
توضیحات ایمنی	S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.;