ChemNet > CAS > 6326-83-6 Bis(carboxymethyl) trithiocarbonate
6326-83-6 Bis(carboxymethyl) trithiocarbonate
| نام محصول |
Bis(carboxymethyl) trithiocarbonate |
| نام انگلیسی |
Bis(carboxymethyl) trithiocarbonate; 3,5-dithia-4-thioxo-1,7-heptanedioic acid; 2,2'-(carbonothioyldisulfanediyl)diacetic acid; 2,2'-(carbonothioyldisulfanediyl)diacetate |
| میدان مغناطیسی |
C5H4O4S3 |
| وزن مولکولی |
224.279 |
| InChI |
InChI=1/C5H6O4S3/c6-3(7)1-11-5(10)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)/p-2 |
| شماره سیایاس |
6326-83-6 |
| تعداد کمیسیون اروپایی |
228-693-7 |
| ساختار مولکولی |
|
| نقطه ذوب |
170-175℃ |
| نقطه غلیان |
532.5°C at 760 mmHg |
| نقطه اشتعال |
275.9°C |
| فشار بخار |
9.26E-13mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
