6373-50-8 4-Cyclohexylaniline
نام محصول |
4-Cyclohexylaniline |
نام انگلیسی |
4-Cyclohexylaniline;1-(2,4-dichlorophenyl)-3-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]urea |
میدان مغناطیسی |
C16H12Cl2N4OS |
وزن مولکولی |
379.2637 |
InChI |
InChI=1/C16H12Cl2N4OS/c1-9-2-4-10(5-3-9)14-21-22-16(24-14)20-15(23)19-13-7-6-11(17)8-12(13)18/h2-8H,1H3,(H2,19,20,22,23) |
شماره سیایاس |
6373-50-8 |
تعداد کمیسیون اروپایی |
228-918-9 |
ساختار مولکولی |
|
تراکم |
1.509g/cm3 |
ضریب شکست |
1.716 |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|