6396-76-5 1-(2,6-Dimethylphenyl)-thiourea

نام محصول	1-(2,6-Dimethylphenyl)-thiourea
نام انگلیسی	1-(2,6-Dimethylphenyl)-thiourea; 2,6-Dimethylphenylthiourea
میدان مغناطیسی	C₉H₁₂N₂S
وزن مولکولی	180.27
InChI	InChI=1/C9H12N2S/c1-6-4-3-5-7(2)8(6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12)
شماره سیایاس	6396-76-5
تعداد کمیسیون اروپایی	229-005-8
ساختار مولکولی
تراکم	1.2g/cm³
نقطه غلیان	284.4°C at 760 mmHg
ضریب شکست	1.674
نقطه اشتعال	125.8°C
فشار بخار	0.00298mmHg at 25°C
خطر نمادها
کدهای خطر	R25:Toxic if swallowed.;
توضیحات ایمنی	S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;