ChemNet > CAS > 64779-10-8 4-(4-octylphenyl)-4-oxobutanoic acid
64779-10-8 4-(4-octylphenyl)-4-oxobutanoic acid
نام محصول |
4-(4-octylphenyl)-4-oxobutanoic acid |
نام انگلیسی |
4-(4-octylphenyl)-4-oxobutanoic acid; |
میدان مغناطیسی |
C18H26O3 |
وزن مولکولی |
290.3972 |
InChI |
InChI=1/C18H26O3/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17(19)13-14-18(20)21/h9-12H,2-8,13-14H2,1H3,(H,20,21) |
شماره سیایاس |
64779-10-8 |
ساختار مولکولی |
|
تراکم |
1.035g/cm3 |
نقطه ذوب |
91℃ |
نقطه غلیان |
463.4°C at 760 mmHg |
ضریب شکست |
1.514 |
نقطه اشتعال |
248.2°C |
فشار بخار |
2.2E-09mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|