ChemNet > CAS > 64910-46-9 3-amino-4-(methylamino)benzonitrile
64910-46-9 3-amino-4-(methylamino)benzonitrile
نام محصول |
3-amino-4-(methylamino)benzonitrile |
نام انگلیسی |
3-amino-4-(methylamino)benzonitrile; |
میدان مغناطیسی |
C8H9N3 |
وزن مولکولی |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
شماره سیایاس |
64910-46-9 |
ساختار مولکولی |
|
تراکم |
1.155g/cm3 |
نقطه ذوب |
136℃ |
نقطه غلیان |
346.783°C at 760 mmHg |
ضریب شکست |
1.593 |
نقطه اشتعال |
163.529°C |
فشار بخار |
0mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|