6587-24-2 methyl 2-cyanobenzoate
نام محصول |
methyl 2-cyanobenzoate |
نام انگلیسی |
methyl 2-cyanobenzoate; |
میدان مغناطیسی |
C9H7NO2 |
وزن مولکولی |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
شماره سیایاس |
6587-24-2 |
ساختار مولکولی |
|
تراکم |
1.18g/cm3 |
نقطه ذوب |
47℃ |
نقطه غلیان |
295.8°C at 760 mmHg |
ضریب شکست |
1.535 |
نقطه اشتعال |
136.2°C |
فشار بخار |
0.00149mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|