6635-41-2 2-Nitrobenzaldoxime
نام محصول |
2-Nitrobenzaldoxime |
نام انگلیسی |
2-Nitrobenzaldoxime; 2-Nitrobenzaldoxime, (2-Nitrobenzaldehyde oxime); 2-Nitrobenzaldehyde oxime; N-hydroxy-1-(2-nitrophenyl)methanimine |
میدان مغناطیسی |
C7H6N2O3 |
وزن مولکولی |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-8-5-6-3-1-2-4-7(6)9(11)12/h1-5,10H/b8-5- |
شماره سیایاس |
6635-41-2 |
تعداد کمیسیون اروپایی |
229-634-8 |
ساختار مولکولی |
|
تراکم |
1.33g/cm3 |
نقطه ذوب |
98-100℃ |
نقطه غلیان |
305.2°C at 760 mmHg |
ضریب شکست |
1.589 |
نقطه اشتعال |
138.4°C |
فشار بخار |
0.000366mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|