ChemNet > CAS > 66424-91-7 5-Methyl-2-nitrobenzyl chloride
66424-91-7 5-Methyl-2-nitrobenzyl chloride
نام محصول |
5-Methyl-2-nitrobenzyl chloride |
نام انگلیسی |
5-Methyl-2-nitrobenzyl chloride; alpha-chloro-5-methyl-2-nitrotoluene; 2-(chloromethyl)-4-methyl-1-nitrobenzene |
میدان مغناطیسی |
C8H8ClNO2 |
وزن مولکولی |
185.6076 |
InChI |
InChI=1/C8H8ClNO2/c1-6-2-3-8(10(11)12)7(4-6)5-9/h2-4H,5H2,1H3 |
شماره سیایاس |
66424-91-7 |
تعداد کمیسیون اروپایی |
266-359-2 |
ساختار مولکولی |
|
تراکم |
1.277g/cm3 |
نقطه ذوب |
41-43℃ |
نقطه غلیان |
292.3°C at 760 mmHg |
ضریب شکست |
1.566 |
نقطه اشتعال |
130.6°C |
فشار بخار |
0.00324mmHg at 25°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|