ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
نام محصول |
2-Amino-5-methoxybenzoic acid |
نام انگلیسی |
2-Amino-5-methoxybenzoic acid; 5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
میدان مغناطیسی |
C8H8N2O |
وزن مولکولی |
148.1619 |
InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
شماره سیایاس |
6705-03-9 |
ساختار مولکولی |
|
تراکم |
1.17g/cm3 |
نقطه ذوب |
148-152℃ |
نقطه غلیان |
302.2°C at 760 mmHg |
ضریب شکست |
1.569 |
نقطه اشتعال |
136.6°C |
فشار بخار |
0.00101mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|