ChemNet > CAS > 6760-14-1 2-Amino-5-nitronicotinic acid
6760-14-1 2-Amino-5-nitronicotinic acid
| نام محصول |
2-Amino-5-nitronicotinic acid |
| نام انگلیسی |
2-Amino-5-nitronicotinic acid; 2-amino-5-nitropyridine-3-carboxylic acid |
| میدان مغناطیسی |
C6H5N3O4 |
| وزن مولکولی |
183.1216 |
| InChI |
InChI=1/C6H5N3O4/c7-5-4(6(10)11)1-3(2-8-5)9(12)13/h1-2H,(H2,7,8)(H,10,11) |
| شماره سیایاس |
6760-14-1 |
| ساختار مولکولی |
|
| تراکم |
1.675g/cm3 |
| نقطه غلیان |
457.4°C at 760 mmHg |
| ضریب شکست |
1.695 |
| نقطه اشتعال |
230.4°C |
| فشار بخار |
3.68E-09mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
