ChemNet > CAS > 6793-92-6;152120-66-6 Benzyloxybromobenzene
6793-92-6;152120-66-6 Benzyloxybromobenzene
| نام محصول |
Benzyloxybromobenzene |
| نام انگلیسی |
Benzyloxybromobenzene; 1-Benzyloxy-4-bromobenzene; 1-Bromo-4-benzyloxybenzene; Benzyl 4-bromophenyl ether; 4-Benzyloxybromobenzene; 5-(TERT-BUTYLDIMETHYLSILYL)-1-METHYL-1H; 1-(Benzyloxy)-4-bromobenzene; Benzene, 1-bromo-4-(phenylmethoxy)-; Benzyl 4-bromophenyl ether; Benzyl p-bromophenyl ether |
| میدان مغناطیسی |
C13H11BrO |
| وزن مولکولی |
263.13 |
| InChI |
InChI=1/C13H11BrO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| شماره سیایاس |
6793-92-6;152120-66-6 |
| ساختار مولکولی |
|
| نقطه ذوب |
60-63℃ |
| نقطه غلیان |
166-167℃ (4 mmHg) |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
