ChemNet > CAS > 67973-32-4 3,5-Dibromo-4-methylbenzoic acid
67973-32-4 3,5-Dibromo-4-methylbenzoic acid
نام محصول |
3,5-Dibromo-4-methylbenzoic acid |
نام انگلیسی |
3,5-Dibromo-4-methylbenzoic acid; 3,5-Dibromo-p-toluic acid (COOH=1); 3,5-Dibromo-p-toluic acid |
میدان مغناطیسی |
C8H6Br2O2 |
وزن مولکولی |
293.94 |
InChI |
InChI=1/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12) |
شماره سیایاس |
67973-32-4 |
ساختار مولکولی |
|
تراکم |
1.951g/cm3 |
نقطه غلیان |
374.6°C at 760 mmHg |
ضریب شکست |
1.627 |
نقطه اشتعال |
180.3°C |
فشار بخار |
2.82E-06mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|