ChemNet > CAS > 68187-29-1 L-گلوتامیک اسید، N-کوکو اسیل مشتق شده.، compds.with triethanolamine (1:1)؛ L-Glutamic acid، N-coco acyl derivs.، compds.با تری اتانول امین؛ TEA-کوکویل گلوتامات؛ تری اتانول امین کوکویل گلوتامات؛ N-Cocoyl-L-گلوتامیک اسید، مونو (تری اتانول امین) نمک؛ L-Glutamic acid، N-coco acyl derivs.، compds.با تری اتانول امین (1:1)؛ l-گلوتامیک اسید، N-کوکو اسیل مشتق، compds.with triethanolamine(1:1)
68187-29-1 L-گلوتامیک اسید، N-کوکو اسیل مشتق شده.، compds.with triethanolamine (1:1)؛ L-Glutamic acid، N-coco acyl derivs.، compds.با تری اتانول امین؛ TEA-کوکویل گلوتامات؛ تری اتانول امین کوکویل گلوتامات؛ N-Cocoyl-L-گلوتامیک اسید، مونو (تری اتانول امین) نمک؛ L-Glutamic acid، N-coco acyl derivs.، compds.با تری اتانول امین (1:1)؛ l-گلوتامیک اسید، N-کوکو اسیل مشتق، compds.with triethanolamine(1:1)
| نام محصول |
L-گلوتامیک اسید، N-کوکو اسیل مشتق شده.، compds.with triethanolamine (1:1)؛ L-Glutamic acid، N-coco acyl derivs.، compds.با تری اتانول امین؛ TEA-کوکویل گلوتامات؛ تری اتانول امین کوکویل گلوتامات؛ N-Cocoyl-L-گلوتامیک اسید، مونو (تری اتانول امین) نمک؛ L-Glutamic acid، N-coco acyl derivs.، compds.با تری اتانول امین (1:1)؛ l-گلوتامیک اسید، N-کوکو اسیل مشتق، compds.with triethanolamine(1:1) |
| نام انگلیسی |
l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine; TEA-Cocoyl glutamate; Triethanolamine cocoyl glutamate; N-Cocoyl-L-glutamic acid, mono(triethanolamine) salt; L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine(1:1); l-Glutamic acid,N-coco acyl derivs.,compds. with triethanolamine(1:1);
|
| میدان مغناطیسی |
C6H15NO3・C5H9NO4 |
| وزن مولکولی |
296.318 |
| InChI |
InChI=1/C6H15NO3.C5H9NO4/c8-4-1-7(2-5-9)3-6-10;6-3(5(9)10)1-2-4(7)8/h8-10H,1-6H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
| شماره سیایاس |
68187-29-1 |
| تعداد کمیسیون اروپایی |
269-084-6 |
| ساختار مولکولی |
|
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
