ChemNet > CAS > 68411-46-1 Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene
68411-46-1 Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene
| نام محصول |
Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene |
| نام انگلیسی |
Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene; N-phenylaniline - 2,4,4-trimethylpent-1-ene (1:1); Antioxidant 5057; Irganox 5057; Quantox-557; Alkyl diphenylamine; AN 5057; N-Phenylbenzenamine reactioin products with 2,4,4-trimethylpentene |
| میدان مغناطیسی |
C20H27N |
| وزن مولکولی |
281.4351 |
| InChI |
InChI=1/C12H11N.C8H16/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2)6-8(3,4)5/h1-10,13H;1,6H2,2-5H3 |
| شماره سیایاس |
68411-46-1 |
| تعداد کمیسیون اروپایی |
270-128-1 |
| ساختار مولکولی |
|
| نقطه غلیان |
302°C at 760 mmHg |
| نقطه اشتعال |
152.8°C |
| فشار بخار |
0.00102mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
