ChemNet > CAS > 68412-48-6 2-Propanone, reaction products with diphenylamine
68412-48-6 2-Propanone, reaction products with diphenylamine
| نام محصول |
2-Propanone, reaction products with diphenylamine |
| نام انگلیسی |
2-Propanone, reaction products with diphenylamine;Acetone diphenylamine condensation products; Acetone, diphenylamine condensation product; Diphenylamine, acetone reaction product; N-Phenylbenzeneamine, 2-propanone reaction product; propan-2-one-N-cyclohexylcyclohexanamine (1:1); propan-2-one-N-phenylaniline (1:1); Acetone Diphenylamine; Antioxidant BLE; Rubber Antioxidant BLE-W; Anti-oxidant agent BLE-W |
| میدان مغناطیسی |
C15H17NO |
| وزن مولکولی |
227.3016 |
| InChI |
InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
| شماره سیایاس |
68412-48-6 |
| تعداد کمیسیون اروپایی |
270-192-0 |
| ساختار مولکولی |
|
| نقطه غلیان |
302°C at 760 mmHg |
| نقطه اشتعال |
152.8°C |
| فشار بخار |
0.00102mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
