6843-66-9 Diphenyldimethoxysilane
نام محصول |
Diphenyldimethoxysilane |
نام انگلیسی |
Diphenyldimethoxysilane; Dimethoxydiphenylsilane; Diphenyl dimethoxylsilicane |
میدان مغناطیسی |
C14H18O2Si |
وزن مولکولی |
246.377 |
InChI |
InChI=1/C12H10.C2H8O2Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;5H2,1-2H3 |
شماره سیایاس |
6843-66-9 |
تعداد کمیسیون اروپایی |
229-929-1 |
ساختار مولکولی |
|
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R38:;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|