699-18-3 2-(2-nitrovinyl)furan
نام محصول |
2-(2-nitrovinyl)furan |
نام انگلیسی |
2-(2-nitrovinyl)furan; |
میدان مغناطیسی |
C6H5NO3 |
وزن مولکولی |
139.11 |
InChI |
InChI=1/C6H5NO3/c8-7(9)4-3-6-2-1-5-10-6/h1-5H/b4-3+ |
شماره سیایاس |
699-18-3 |
ساختار مولکولی |
|
نقطه ذوب |
72-75℃ |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|