704-38-1 Bis(2-thienyl) ketone
نام محصول |
Bis(2-thienyl) ketone |
نام انگلیسی |
Bis(2-thienyl) ketone; Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
میدان مغناطیسی |
C9H6OS2 |
وزن مولکولی |
194.2733 |
InChI |
InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
شماره سیایاس |
704-38-1 |
ساختار مولکولی |
|
تراکم |
1.326g/cm3 |
نقطه ذوب |
89-91℃ |
نقطه غلیان |
323°C at 760 mmHg |
ضریب شکست |
1.64 |
نقطه اشتعال |
149.1°C |
فشار بخار |
0.00027mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|