ChemNet > CAS > 7152-40-1 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile
7152-40-1 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile
| نام محصول |
5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile |
| نام انگلیسی |
5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile; 1H-pyrazole-3-acetonitrile, 5-amino-4-cyano-1-phenyl-; 1H-Pyrazole-4-carbonitrile, 5-amino-3-cyanomethyl-1-phenyl-; 5-Amino-3-cyanomethyl-1-phenyl-1H-pyrazole-4-carbonitrile |
| میدان مغناطیسی |
C12H9N5 |
| وزن مولکولی |
223.2334 |
| InChI |
InChI=1/C12H9N5/c13-7-6-11-10(8-14)12(15)17(16-11)9-4-2-1-3-5-9/h1-5H,6,15H2 |
| شماره سیایاس |
7152-40-1 |
| تعداد کمیسیون اروپایی |
230-496-6 |
| ساختار مولکولی |
|
| تراکم |
1.27g/cm3 |
| نقطه ذوب |
165.5-166.5℃ |
| نقطه غلیان |
486.8°C at 760 mmHg |
| ضریب شکست |
1.673 |
| نقطه اشتعال |
248.2°C |
| فشار بخار |
1.26E-09mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
