ChemNet > CAS > 71735-21-2 (2,4-Dichloro-5-methylphenylthio)acetic acid
71735-21-2 (2,4-Dichloro-5-methylphenylthio)acetic acid
نام محصول |
(2,4-Dichloro-5-methylphenylthio)acetic acid |
نام انگلیسی |
(2,4-Dichloro-5-methylphenylthio)acetic acid;((2,4-Dichloro-5-methylphenyl)thio)acetic acid; [(2,4-dichloro-5-methylphenyl)sulfanyl]acetic acid |
میدان مغناطیسی |
C9H8Cl2O2S |
وزن مولکولی |
251.1296 |
InChI |
InChI=1/C9H8Cl2O2S/c1-5-2-8(14-4-9(12)13)7(11)3-6(5)10/h2-3H,4H2,1H3,(H,12,13) |
شماره سیایاس |
71735-21-2 |
تعداد کمیسیون اروپایی |
275-933-1 |
ساختار مولکولی |
|
تراکم |
1.47g/cm3 |
نقطه غلیان |
371.2°C at 760 mmHg |
ضریب شکست |
1.623 |
نقطه اشتعال |
178.3°C |
فشار بخار |
3.64E-06mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|