ChemNet > CAS > 71902-33-5 3,5-Difluoropyridine
71902-33-5 3,5-Difluoropyridine
| نام محصول |
3,5-Difluoropyridine |
| نام انگلیسی |
3,5-Difluoropyridine; |
| میدان مغناطیسی |
C5H3F2N |
| وزن مولکولی |
115.0808 |
| InChI |
InChI=1/C5H3F2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| شماره سیایاس |
71902-33-5 |
| ساختار مولکولی |
|
| تراکم |
1.263g/cm3 |
| نقطه غلیان |
79.4°C at 760 mmHg |
| ضریب شکست |
1.446 |
| نقطه اشتعال |
1.9°C |
| فشار بخار |
98.5mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
