ChemNet > CAS > 7197-96-8 2,3-cycloheptenopyridine
7197-96-8 2,3-cycloheptenopyridine
نام محصول |
2,3-cycloheptenopyridine |
نام انگلیسی |
2,3-cycloheptenopyridine; |
میدان مغناطیسی |
C10H13N |
وزن مولکولی |
147.2169 |
InChI |
InChI=1/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2 |
شماره سیایاس |
7197-96-8 |
تعداد کمیسیون اروپایی |
230-568-7 |
ساختار مولکولی |
|
تراکم |
0.999g/cm3 |
نقطه غلیان |
224.9°C at 760 mmHg |
ضریب شکست |
1.533 |
نقطه اشتعال |
93.3°C |
فشار بخار |
0.133mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|