72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene

نام محصول	2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
نام انگلیسی	2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE
میدان مغناطیسی	C₁₄H₈Cl₄
وزن مولکولی	318.02
InChI	InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H
شماره سیایاس	72-55-9
تعداد کمیسیون اروپایی	200-784-6
ساختار مولکولی
نقطه ذوب	87-90℃
حلالیت آب	0.00000013 g/100 mL
خطر نمادها	Xn:Harmful;
کدهای خطر	R22:Harmful if swallowed.; R33:Danger of cummulative effects.;
توضیحات ایمنی	S24/25:Avoid contact with skin and eyes.;