ChemNet > CAS > 7206-70-4 4-Amino-5-chloro-2-methoxybenzoic acid
7206-70-4 4-Amino-5-chloro-2-methoxybenzoic acid
| نام محصول |
4-Amino-5-chloro-2-methoxybenzoic acid |
| نام انگلیسی |
4-Amino-5-chloro-2-methoxybenzoic acid;4-amino-5-chloro-2-methoxybenzoate |
| میدان مغناطیسی |
C8H7ClNO3 |
| وزن مولکولی |
200.5996 |
| InChI |
InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12)/p-1 |
| شماره سیایاس |
7206-70-4 |
| تعداد کمیسیون اروپایی |
230-582-3 |
| ساختار مولکولی |
|
| نقطه ذوب |
206-210℃ |
| نقطه غلیان |
369.7°C at 760 mmHg |
| نقطه اشتعال |
177.4°C |
| فشار بخار |
4.06E-06mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R22:Harmful if swallowed.;
|
| توضیحات ایمنی |
S28B:After contact with skin, wash immediately with plenty of water and soap.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
|
|
