ChemNet > CAS > 72065-23-7 N-Acryloylsarcosine methyl ester
72065-23-7 N-Acryloylsarcosine methyl ester
| نام محصول |
N-Acryloylsarcosine methyl ester |
| نام انگلیسی |
N-Acryloylsarcosine methyl ester;methyl N-acryloyl-N-methylglycinate |
| میدان مغناطیسی |
C7H11NO3 |
| وزن مولکولی |
157.1671 |
| InChI |
InChI=1/C7H11NO3/c1-4-6(9)8(2)5-7(10)11-3/h4H,1,5H2,2-3H3 |
| شماره سیایاس |
72065-23-7 |
| ساختار مولکولی |
|
| تراکم |
1.068g/cm3 |
| نقطه غلیان |
276.3°C at 760 mmHg |
| ضریب شکست |
1.452 |
| نقطه اشتعال |
120.9°C |
| فشار بخار |
0.00485mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
