728-87-0 4,4'-Dimethoxybenzhydrol
نام محصول |
4,4'-Dimethoxybenzhydrol |
نام انگلیسی |
4,4'-Dimethoxybenzhydrol; Bis(4-methoxyphenyl) carbinol; 4,4-Dimethoxydiphenylmethanol; 4,4-Dimethoxybenzhydrol; Bis(4-methoxyphenyl)carbinol; bis(4-methoxyphenyl)methanol |
میدان مغناطیسی |
C15H16O3 |
وزن مولکولی |
244.2857 |
InChI |
InChI=1/C15H16O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15-16H,1-2H3 |
شماره سیایاس |
728-87-0 |
تعداد کمیسیون اروپایی |
211-975-9 |
ساختار مولکولی |
|
تراکم |
1.135g/cm3 |
نقطه ذوب |
68-72℃ |
نقطه غلیان |
406.5°C at 760 mmHg |
ضریب شکست |
1.568 |
نقطه اشتعال |
199.6°C |
فشار بخار |
2.46E-07mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|