ChemNet > CAS > 73033-58-6 5-Chloro-2-nitrobenzyl alcohol
73033-58-6 5-Chloro-2-nitrobenzyl alcohol
| نام محصول |
5-Chloro-2-nitrobenzyl alcohol |
| نام انگلیسی |
5-Chloro-2-nitrobenzyl alcohol; (5-chloro-2-nitrophenyl)methanol; 5-Chloro-2-nitrobenzenemethanol |
| میدان مغناطیسی |
C7H6ClNO3 |
| وزن مولکولی |
187.5804 |
| InChI |
InChI=1/C7H6ClNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-3,10H,4H2 |
| شماره سیایاس |
73033-58-6 |
| تعداد کمیسیون اروپایی |
277-241-5 |
| ساختار مولکولی |
|
| تراکم |
1.476g/cm3 |
| نقطه ذوب |
77-82℃ |
| نقطه غلیان |
316.1°C at 760 mmHg |
| ضریب شکست |
1.611 |
| نقطه اشتعال |
145°C |
| فشار بخار |
0.000176mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
