ChemNet > CAS > 738-66-9 N,N'-Bis(4-nitrophenyl)carbodiimide
738-66-9 N,N'-Bis(4-nitrophenyl)carbodiimide
نام محصول |
N,N'-Bis(4-nitrophenyl)carbodiimide |
نام انگلیسی |
N,N'-Bis(4-nitrophenyl)carbodiimide; |
میدان مغناطیسی |
C13H8N4O4 |
وزن مولکولی |
284.227 |
InChI |
InChI=1/C13H8N4O4/c18-16(19)12-5-1-10(2-6-12)14-9-15-11-3-7-13(8-4-11)17(20)21/h1-8H |
شماره سیایاس |
738-66-9 |
تعداد کمیسیون اروپایی |
212-005-7 |
ساختار مولکولی |
|
تراکم |
1.38g/cm3 |
نقطه ذوب |
166-168℃ |
نقطه غلیان |
517.6°C at 760 mmHg |
ضریب شکست |
1.649 |
نقطه اشتعال |
266.8°C |
فشار بخار |
2.66E-10mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|