ChemNet > CAS > 7391-28-8 4-Methylbenzoylacetonitrile
7391-28-8 4-Methylbenzoylacetonitrile
نام محصول |
4-Methylbenzoylacetonitrile |
نام انگلیسی |
4-Methylbenzoylacetonitrile; p-Toluoylacetonitrile; 3-oxo-3-p-tolylpropanenitrile; 3-(4-methylphenyl)-3-oxopropanenitrile |
میدان مغناطیسی |
C10H9NO |
وزن مولکولی |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-8-2-4-9(5-3-8)10(12)6-7-11/h2-5H,6H2,1H3 |
شماره سیایاس |
7391-28-8 |
ساختار مولکولی |
|
تراکم |
1.081g/cm3 |
نقطه ذوب |
100-102℃ |
نقطه غلیان |
318.2°C at 760 mmHg |
ضریب شکست |
1.532 |
نقطه اشتعال |
146.2°C |
فشار بخار |
0.000367mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|