75-27-4 Bromodichloromethane
نام محصول |
Bromodichloromethane |
نام انگلیسی |
Bromodichloromethane; FC-20B1 |
میدان مغناطیسی |
CHBrCl2 |
وزن مولکولی |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
شماره سیایاس |
75-27-4 |
تعداد کمیسیون اروپایی |
200-856-7 |
ساختار مولکولی |
|
تراکم |
2.013g/cm3 |
نقطه ذوب |
-55℃ |
نقطه غلیان |
89.7°C at 760 mmHg |
ضریب شکست |
1.503 |
نقطه اشتعال |
1.3°C |
فشار بخار |
65.3mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|