ChemNet > CAS > 766-39-2 2,3-Dimethylmaleic anhydride
766-39-2 2,3-Dimethylmaleic anhydride
نام محصول |
2,3-Dimethylmaleic anhydride |
نام انگلیسی |
2,3-Dimethylmaleic anhydride; 3,4-Dimethyl-2,5-furandione; 3,4-dimethylfuran-2,5-dione; 4,5-Dimethyl-1,3-Dioxa-2-Oxo-Cyclopentene; 2,3-Dimethyl maleic anhydride |
میدان مغناطیسی |
C6H6O3 |
وزن مولکولی |
126.11 |
InChI |
InChI=1/C6H6O3/c1-3-4(2)6(8)9-5(3)7/h1-2H3 |
شماره سیایاس |
766-39-2 |
تعداد کمیسیون اروپایی |
212-165-8 |
ساختار مولکولی |
|
تراکم |
1.236g/cm3 |
نقطه ذوب |
93-96℃ |
نقطه غلیان |
223°C at 760 mmHg |
ضریب شکست |
1.486 |
نقطه اشتعال |
95.6°C |
فشار بخار |
0.0986mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|