ChemNet > CAS > 771-56-2 methyl pentafluorobenzene
771-56-2 methyl pentafluorobenzene
نام محصول |
methyl pentafluorobenzene |
نام انگلیسی |
methyl pentafluorobenzene; 2,3,4,5,6-Pentafluorotoluene; Methylpentafluorobenzene |
میدان مغناطیسی |
C7H3F5 |
وزن مولکولی |
182.09 |
InChI |
InChI=1/C7H3F5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
شماره سیایاس |
771-56-2 |
تعداد کمیسیون اروپایی |
212-233-7 |
ساختار مولکولی |
|
تراکم |
1.44 |
نقطه غلیان |
117℃ |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|