ChemNet > CAS > 81452-54-2 Methyl 3-methylthiophene-2-carboxylate
81452-54-2 Methyl 3-methylthiophene-2-carboxylate
| نام محصول |
Methyl 3-methylthiophene-2-carboxylate |
| نام انگلیسی |
Methyl 3-methylthiophene-2-carboxylate; 3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
| میدان مغناطیسی |
C7H8O2S |
| وزن مولکولی |
156.2022 |
| InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
| شماره سیایاس |
81452-54-2 |
| ساختار مولکولی |
|
| تراکم |
1.173g/cm3 |
| نقطه غلیان |
211°C at 760 mmHg |
| ضریب شکست |
1.531 |
| نقطه اشتعال |
81.4°C |
| فشار بخار |
0.186mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
