ChemNet > CAS > 823-76-7 Cyclohexyl methyl ketone
823-76-7 Cyclohexyl methyl ketone
| نام محصول |
Cyclohexyl methyl ketone |
| نام انگلیسی |
Cyclohexyl methyl ketone; Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone; Acetylcyclohexane; 1-cyclohexylethanone; 1-CYCLOHEXYLETHAN-1-ONE |
| میدان مغناطیسی |
C8H14O |
| وزن مولکولی |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
| شماره سیایاس |
823-76-7 |
| تعداد کمیسیون اروپایی |
212-517-0 |
| ساختار مولکولی |
|
| تراکم |
0.916g/cm3 |
| نقطه غلیان |
181.5°C at 760 mmHg |
| ضریب شکست |
1.448 |
| نقطه اشتعال |
61.4°C |
| فشار بخار |
0.849mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
