ChemNet > CAS > 82366-55-0 4-Dimethylamino-3,5-dinitrobenzoic acid
82366-55-0 4-Dimethylamino-3,5-dinitrobenzoic acid
نام محصول |
4-Dimethylamino-3,5-dinitrobenzoic acid |
نام انگلیسی |
4-Dimethylamino-3,5-dinitrobenzoic acid;4-(dimethylamino)-3,5-dinitrobenzoate |
میدان مغناطیسی |
C9H8N3O6 |
وزن مولکولی |
254.1769 |
InChI |
InChI=1/C9H9N3O6/c1-10(2)8-6(11(15)16)3-5(9(13)14)4-7(8)12(17)18/h3-4H,1-2H3,(H,13,14)/p-1 |
شماره سیایاس |
82366-55-0 |
ساختار مولکولی |
|
نقطه غلیان |
424.7°C at 760 mmHg |
نقطه اشتعال |
210.6°C |
فشار بخار |
5.71E-08mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|