ChemNet > CAS > 824-55-5 1-(chloromethyl)-2,4-dimethylbenzene
824-55-5 1-(chloromethyl)-2,4-dimethylbenzene
| نام محصول |
1-(chloromethyl)-2,4-dimethylbenzene |
| نام انگلیسی |
1-(chloromethyl)-2,4-dimethylbenzene; 2,4-Dimethylbenzyl chloride; 4-(Chloromethyl)-m-xylene; 2,4-Dimethylbenzylchloride |
| میدان مغناطیسی |
C9H11Cl |
| وزن مولکولی |
154.6366 |
| InChI |
InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
| شماره سیایاس |
824-55-5 |
| تعداد کمیسیون اروپایی |
212-531-7 |
| ساختار مولکولی |
|
| تراکم |
1.033g/cm3 |
| نقطه غلیان |
215.5°C at 760 mmHg |
| ضریب شکست |
1.522 |
| نقطه اشتعال |
86.5°C |
| فشار بخار |
0.216mmHg at 25°C |
| خطر نمادها |
 C:Corrosive;
|
| کدهای خطر |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
