ChemNet > CAS > 825-52-5 2-hydroxyimino-2-phenylacetonitrile, mixture
825-52-5 2-hydroxyimino-2-phenylacetonitrile, mixture
| نام محصول |
2-hydroxyimino-2-phenylacetonitrile, mixture |
| نام انگلیسی |
2-hydroxyimino-2-phenylacetonitrile, mixture; 2-Hydroxyimino-2-phenylacetonitrile; Benzoyl cyanide oxime~Phenylglyoxylonitrile oxime; (hydroxyimino)(phenyl)acetonitrile; (2E)-(hydroxyimino)(phenyl)ethanenitrile |
| میدان مغناطیسی |
C8H6N2O |
| وزن مولکولی |
146.146 |
| InChI |
InChI=1/C8H6N2O/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H/b10-8- |
| شماره سیایاس |
825-52-5 |
| تعداد کمیسیون اروپایی |
212-546-9 |
| ساختار مولکولی |
|
| تراکم |
1.11g/cm3 |
| نقطه ذوب |
128-130℃ |
| نقطه غلیان |
293.3°C at 760 mmHg |
| ضریب شکست |
1.562 |
| نقطه اشتعال |
131.2°C |
| فشار بخار |
0.000793mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
