ChemNet > CAS > 827-15-6 iodopentafluorobenzene
827-15-6 iodopentafluorobenzene
| نام محصول |
iodopentafluorobenzene |
| نام انگلیسی |
iodopentafluorobenzene; Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene; 1-Iodo-2,3,4,5,6-Pentafluorobenzene |
| میدان مغناطیسی |
C6F5I |
| وزن مولکولی |
293.9607 |
| InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| شماره سیایاس |
827-15-6 |
| تعداد کمیسیون اروپایی |
212-565-2 |
| ساختار مولکولی |
|
| تراکم |
2.217g/cm3 |
| نقطه غلیان |
166.7°C at 760 mmHg |
| ضریب شکست |
1.502 |
| نقطه اشتعال |
61.3°C |
| فشار بخار |
2.33mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
