ChemNet > CAS > 84347-67-1 cis-N-(4-Chlorobutenyl)phthalimide
84347-67-1 cis-N-(4-Chlorobutenyl)phthalimide
نام محصول |
cis-N-(4-Chlorobutenyl)phthalimide |
نام انگلیسی |
cis-N-(4-Chlorobutenyl)phthalimide;2-[(2Z)-4-chlorobut-2-en-1-yl]-1H-isoindole-1,3(2H)-dione |
میدان مغناطیسی |
C12H10ClNO2 |
وزن مولکولی |
235.6663 |
InChI |
InChI=1/C12H10ClNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-6H,7-8H2/b4-3- |
شماره سیایاس |
84347-67-1 |
ساختار مولکولی |
|
تراکم |
1.322g/cm3 |
نقطه ذوب |
79℃ |
نقطه غلیان |
374.2°C at 760 mmHg |
ضریب شکست |
1.602 |
نقطه اشتعال |
180.1°C |
فشار بخار |
8.52E-06mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|